AI11676
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 99% | in stock | $16.00 | $11.00 | - + | |
1g | 99% | in stock | $40.00 | $28.00 | - + | |
5g | 99% | in stock | $135.00 | $94.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI11676 |
Chemical Name: | (Z)-2-((Furan-2-ylmethyl)sulfinyl)-n-(4-((3-(piperidin-1-ylmethyl)pyridin-2-yl)oxy)but-2-en-1-yl)acetamide |
CAS Number: | 118288-08-7 |
Molecular Formula: | C22H29N3O4S |
Molecular Weight: | 431.5484 |
MDL Number: | MFCD00867520 |
SMILES: | O=C(CS(=O)Cc1ccco1)NCC=CCOc1ncccc1CN1CCCCC1 |
Lafutidine, a pharmaceutical compound belonging to the class of histamine H2-receptor antagonists, finds a unique application in chemical synthesis. In organic chemistry, Lafutidine is utilized as a key building block in the preparation of various molecules with potential biological activity. Its versatility in synthetic pathways enables the creation of complex structures necessary for drug development and medicinal chemistry research. By serving as a precursor in the synthesis of novel compounds, Lafutidine plays a crucial role in advancing the field of pharmaceuticals and expanding the repertoire of potential therapeutic agents.