AI67528
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 90% | in stock | $40.00 | $28.00 | - + | |
250mg | 90% | in stock | $47.00 | $33.00 | - + | |
1g | 90% | in stock | $117.00 | $82.00 | - + | |
5g | 90% | in stock | $369.00 | $259.00 | - + | |
10g | 90% | in stock | $646.00 | $452.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI67528 |
Chemical Name: | Beta-nicotinamide adenine dinucleotide phosphate sodium salt hydrate |
CAS Number: | 1184-16-3 |
Molecular Formula: | C21H27N7NaO17P3 |
Molecular Weight: | 765.3868 |
MDL Number: | MFCD00036973 |
SMILES: | O[C@@H]1[C@H](O)[C@H](O[C@H]1[n+]1cccc(c1)C(=O)N)COP(=O)(OP(=O)(OC[C@H]1O[C@H]([C@@H]([C@@H]1O)OP(=O)(O)O)n1cnc2c1ncnc2N)[O-])[O-].[Na+] |
Complexity: | 1290 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 8 |
Heavy Atom Count: | 49 |
Hydrogen Bond Acceptor Count: | 21 |
Hydrogen Bond Donor Count: | 7 |
Rotatable Bond Count: | 13 |
NADP sodium, also known as Nicotinamide Adenine Dinucleotide Phosphate sodium, is a crucial coenzyme that plays a pivotal role in various chemical synthesis processes. This versatile compound is commonly employed as a reducing agent in enzymatic reactions, particularly in biosynthetic pathways that require the transfer of electrons. Its ability to donate and accept electrons makes it an essential component in the conversion of chemical compounds, aiding in the synthesis of essential biomolecules such as amino acids, fatty acids, and nucleotides. NADP sodium's involvement in these reactions facilitates the production of key building blocks necessary for the growth and maintenance of living organisms.Furthermore, NADP sodium is utilized in the pharmaceutical industry for the synthesis of various drugs and pharmaceutical intermediates. Its role in chemical synthesis extends to the production of fine chemicals, agrochemicals, and specialty materials, highlighting its significance in modern industrial processes.Overall, NADP sodium's application in chemical synthesis underscores its importance as a versatile coenzyme that enables the efficient production of a wide range of essential compounds across various industries.