logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Other Aromatic Heterocycles  > 2-Bromo-5h-pyrrolo[2,3-b]pyrazine-7-carbaldehyde

AE23326

1185428-32-3 | 2-Bromo-5h-pyrrolo[2,3-b]pyrazine-7-carbaldehyde

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $42.00 $30.00 -   +
250mg 95% in stock $55.00 $39.00 -   +
1g 95% in stock $129.00 $90.00 -   +
10g 95% in stock $1,232.00 $862.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE23326
Chemical Name: 2-Bromo-5h-pyrrolo[2,3-b]pyrazine-7-carbaldehyde
CAS Number: 1185428-32-3
Molecular Formula: C7H4BrN3O
Molecular Weight: 226.0302
MDL Number: MFCD17015976
SMILES: Brc1cnc2c(n1)c(C=O)c[nH]2

 

Computed Properties
Complexity: 190  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 12  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 1  
XLogP3: 0.8  

 

 

Upstream Synthesis Route
  • 2-Bromo-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde is a versatile compound commonly used in chemical synthesis for its unique properties and applications. As a key intermediate in organic chemistry, this compound is valued for its ability to act as a starting material for the synthesis of various heterocyclic compounds and pharmaceuticals. Its reactive aldehyde group allows for efficient functionalization, enabling the creation of diverse molecular structures. Furthermore, the presence of the bromine atom facilitates important cross-coupling reactions, making it a valuable building block in the synthesis of complex organic molecules. Additionally, the distinct pyrrolopyrazine ring system confers specific reactivity and structural features that are beneficial for the creation of novel molecules with potential biological activity. Overall, 2-Bromo-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde plays a crucial role in enabling the efficient synthesis of advanced molecules in the field of organic chemistry.
FEATURED PRODUCTS