logo
Home  > 2-(2-Cyclopropylmethoxy-5-methylphenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane

AE11818

1185836-99-0 | 2-(2-Cyclopropylmethoxy-5-methylphenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane

Packsize Purity Availability Price Discounted Price    Quantity
100mg 96% in stock $124.00 $87.00 -   +
250mg 96% in stock $200.00 $140.00 -   +
1g 96% in stock $500.00 $350.00 -   +
5g 96% in stock $1,955.00 $1,369.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE11818
Chemical Name: 2-(2-Cyclopropylmethoxy-5-methylphenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane
CAS Number: 1185836-99-0
Molecular Formula: C17H25BO3
Molecular Weight: 288.1896
MDL Number: MFCD13152008
SMILES: Cc1ccc(c(c1)B1OC(C(O1)(C)C)(C)C)OCC1CC1

 

Upstream Synthesis Route 
  • In chemical synthesis, 2-[2-(Cyclopropylmethoxy)-5-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane serves as a versatile building block that plays a crucial role in various organic reactions. Due to its unique structure and reactivity, this compound is widely used as a boron-containing reagent in cross-coupling reactions, particularly in the formation of carbon-carbon bonds. Its cyclopropylmethoxy and methylphenyl groups, along with the tetramethyl boron moiety, enable selective and efficient transformations in organic synthesis. Additionally, the dioxaborolane functionality offers stability and compatibility with different reaction conditions, making it a valuable tool for the construction of complex molecular structures and the synthesis of pharmaceuticals, agrochemicals, and advanced materials.
FEATURED PRODUCTS