logo
Home  > Ho-peg(12)-co-otbu

AE21063

1186025-29-5 | Ho-peg(12)-co-otbu

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $198.00 $138.00 -   +
250mg 95% in stock $348.00 $243.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE21063
Chemical Name: Ho-peg(12)-co-otbu
CAS Number: 1186025-29-5
Molecular Formula: C55H110O27
Molecular Weight: 1203.4457000000014
MDL Number: MFCD13185018
SMILES: OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • The compound α-[3-(1,1-Dimethylethoxy)-3-oxopropyl]-ω-hydroxypoly(oxy-1,2-ethanediyl) serves as a versatile building block in chemical synthesis processes. Its unique structure and functional groups make it particularly suitable for use as a core component in the creation of complex polymers and organic compounds. This compound can be utilized in the development of advanced materials, pharmaceuticals, and specialty chemicals through various synthetic routes. Its presence in a chemical synthesis reaction can facilitate the formation of tailored structures and properties, enhancing the overall efficiency and specificity of the desired product.
FEATURED PRODUCTS