AE15366
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $119.00 | $84.00 | - + | |
250mg | 98% | in stock | $193.00 | $135.00 | - + | |
1g | 98% | in stock | $516.00 | $361.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE15366 |
Chemical Name: | (3aR,8aR)-(-)-4,4,8,8-Tetrakis(3,5-diethylphenyl) tetrahydro-2,2-diMethyl-6-phenyl-1,3-dioxolo [4,5-e]dioxaphosphepin |
CAS Number: | 1187446-93-0 |
Molecular Formula: | C53H65O4P |
Molecular Weight: | 797.0546 |
MDL Number: | MFCD23704801 |
SMILES: | CCc1cc(CC)cc(c1)C1(OP(OC([C@H]2[C@H]1OC(O2)(C)C)(c1cc(CC)cc(c1)CC)c1cc(CC)cc(c1)CC)c1ccccc1)c1cc(CC)cc(c1)CC |
The compound (3aR,8aR)-4,4,8,8-Tetrakis(3,5-diethylphenyl)-2,2-dimethyl-6-phenyltetrahydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine is a versatile building block in chemical synthesis. This unique molecule plays a crucial role in various synthetic reactions due to its structural features and reactivity. Specifically, it can be utilized as a chiral ligand in asymmetric catalysis, aiding in the formation of enantioenriched products with high selectivity. Furthermore, its rigid and sterically demanding structure allows for precise control over the stereochemistry of the synthesized compounds. Additionally, this compound can serve as a functional group modifier, enabling the introduction of specific functionalities into target molecules. Its flexible nature and ability to participate in a range of chemical transformations make it a valuable tool for organic chemists seeking to streamline the synthesis of complex molecules.