AI12069
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $105.00 | $74.00 | - + | |
5g | 96% | in stock | $297.00 | $208.00 | - + | |
10g | 96% | in stock | $448.00 | $314.00 | - + | |
25g | 96% | in stock | $758.00 | $531.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI12069 |
Chemical Name: | tert-Butyl N-(3-bromo-5-chlorophenyl)carbamate |
CAS Number: | 1187932-42-8 |
Molecular Formula: | C11H13BrClNO2 |
Molecular Weight: | 306.5834 |
MDL Number: | MFCD12913728 |
SMILES: | O=C(OC(C)(C)C)Nc1cc(Cl)cc(c1)Br |
Complexity: | 255 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.8 |
The Carbamic acid, N-(3-bromo-5-chlorophenyl)-, 1,1-dimethylethyl ester plays a crucial role in chemical synthesis as a versatile building block. This compound is commonly utilized as a key intermediate in the production of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique chemical structure offers a wide range of synthetic possibilities, allowing for the creation of diverse molecular architectures with specific functions and properties. By incorporating this compound into synthetic pathways, chemists can efficiently access new and complex molecules, enabling the development of innovative materials and biologically active compounds.