AB50003
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $24.00 | $17.00 | - + | |
1g | 95% | in stock | $168.00 | $118.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50003 |
Chemical Name: | 1-BOC-7-Bromo-3,4-dihydro-2H-quinoline |
CAS Number: | 1187932-64-4 |
Molecular Formula: | C14H18BrNO2 |
Molecular Weight: | 312.2022 |
MDL Number: | MFCD12913865 |
SMILES: | O=C(N1CCCc2c1cc(Br)cc2)OC(C)(C)C |
Complexity: | 313 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.8 |
The tert-Butyl 7-bromo-3,4-dihydroquinoline-1(2H)-carboxylate serves as a valuable intermediate in chemical synthesis processes, particularly in the field of medicinal and pharmaceutical chemistry. This compound is utilized in the creation of diverse organic molecules due to its versatile reactivity and functional group compatibility. In various synthetic routes, tert-Butyl 7-bromo-3,4-dihydroquinoline-1(2H)-carboxylate acts as a crucial building block, enabling the formation of complex structures and enabling the modification of key pharmacophores. Its unique structural features make it a promising candidate for the development of novel pharmaceutical agents and bioactive compounds.