AE23050
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $249.00 | $174.00 | - + | |
1g | 95% | in stock | $556.00 | $390.00 | - + | |
5g | 95% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE23050 |
Chemical Name: | tert-Butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate |
CAS Number: | 1187933-34-1 |
Molecular Formula: | C15H19NO3 |
Molecular Weight: | 261.3163 |
MDL Number: | MFCD11858409 |
SMILES: | O=Cc1ccc2c(c1)CCCN2C(=O)OC(C)(C)C |
Complexity: | 348 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.5 |
The tert-Butyl 6-formyl-3,4-dihydroquinoline-1(2H)-carboxylate is widely utilized in chemical synthesis as a key intermediate in the preparation of various organic compounds. This compound serves as a versatile building block due to its unique structural features, enabling its application in the creation of complex molecules with diverse functionalities. In particular, tert-Butyl 6-formyl-3,4-dihydroquinoline-1(2H)-carboxylate is commonly employed in the development of pharmaceuticals, agrochemicals, and materials science, where its manipulation through various chemical reactions allows for the efficient synthesis of novel substances. By harnessing the reactivity and molecular properties of this compound, chemists are able to design and produce a wide range of valuable products that contribute to advancements in various industries.