AD59527
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $7.00 | $5.00 | - + | |
1g | 98% | in stock | $9.00 | $6.00 | - + | |
5g | 98% | in stock | $11.00 | $8.00 | - + | |
10g | 95% | in stock | $12.00 | $9.00 | - + | |
25g | 95% | in stock | $22.00 | $16.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD59527 |
Chemical Name: | 1-Boc-4-(tosyloxy)piperidine |
CAS Number: | 118811-07-7 |
Molecular Formula: | C17H25NO5S |
Molecular Weight: | 355.4491 |
MDL Number: | MFCD06796535 |
SMILES: | Cc1ccc(cc1)S(=O)(=O)OC1CCN(CC1)C(=O)OC(C)(C)C |
Complexity: | 518 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 5 |
XLogP3: | 3 |
Journal of the American Chemical Society 20020306