AE18712
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $137.00 | $96.00 | - + | |
1g | 96% | in stock | $314.00 | $220.00 | - + | |
5g | 96% | in stock | $867.00 | $607.00 | - + | |
10g | 96% | in stock | $1,317.00 | $922.00 | - + | |
25g | 96% | in stock | $2,623.00 | $1,836.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE18712 |
Chemical Name: | tert-Butyl ((4-hydroxycyclohexyl)methyl)carbamate |
CAS Number: | 1188475-96-8 |
Molecular Formula: | C12H23NO3 |
Molecular Weight: | 229.3159 |
MDL Number: | MFCD16620881 |
SMILES: | OC1CCC(CC1)CNC(=O)OC(C)(C)C |
Complexity: | 227 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.8 |
The tert-Butyl ((4-hydroxycyclohexyl)methyl)carbamate is a versatile compound widely utilized in chemical synthesis as a protective group for hydroxyl functionalities. This compound serves as a valuable tool in organic chemistry reactions where the protection of hydroxyl groups is necessary to control selectivity and prevent unwanted side reactions. By introducing this tert-Butyl carbamate moiety, the hydroxyl group's reactivity can be masked, allowing for specific transformations to occur selectively at other functional groups present in the molecule. This strategic use of tert-Butyl ((4-hydroxycyclohexyl)methyl)carbamate enables chemists to manipulate complex molecules with precision, facilitating the synthesis of a diverse range of organic compounds with tailored properties and functionalities.