AX63336
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $22.00 | $15.00 | - + | |
5mg | 99% | in stock | $53.00 | $37.00 | - + | |
10mg | 99% | in stock | $80.00 | $56.00 | - + | |
50mg | 99% | in stock | $232.00 | $162.00 | - + | |
100mg | 99% | in stock | $392.00 | $274.00 | - + | |
250mg | 99% | in stock | $665.00 | $465.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX63336 |
Chemical Name: | Pyrido[2,3-d]pyrimidin-4-amine, 5-(3-bromophenyl)-7-[6-(4-morpholinyl)-3-pyridinyl]-, hydrochloride (1:2) |
CAS Number: | 1188890-28-9 |
Molecular Formula: | C22H21BrCl2N6O |
Molecular Weight: | 536.2517 |
MDL Number: | MFCD03452809 |
SMILES: | Brc1cccc(c1)c1cc(nc2c1c(N)ncn2)c1ccc(nc1)N1CCOCC1.Cl.Cl |
Pyrido[2,3-d]pyrimidin-4-amine, 5-(3-bromophenyl)-7-[6-(4-morpholinyl)-3-pyridinyl]-, hydrochloride (1:2) is a versatile compound commonly employed in chemical synthesis processes. This compound plays a crucial role as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and materials. Its unique chemical structure makes it a valuable building block for the preparation of diverse heterocyclic compounds.In chemical synthesis, Pyrido[2,3-d]pyrimidin-4-amine, 5-(3-bromophenyl)-7-[6-(4-morpholinyl)-3-pyridinyl]-, hydrochloride (1:2) serves as a strategic starting material for the construction of complex molecular structures. Its functional groups enable efficient coupling reactions and functionalization steps, allowing chemists to introduce specific modifications tailored to the desired target molecule. By utilizing this compound, chemists can access novel compounds with potentially valuable properties for various applications.Overall, the application of Pyrido[2,3-d]pyrimidin-4-amine, 5-(3-bromophenyl)-7-[6-(4-morpholinyl)-3-pyridinyl]-, hydrochloride (1:2) in chemical synthesis demonstrates its significance in modern organic chemistry as a versatile and indispensable component for the creation of diverse compounds with potential pharmaceutical, agricultural, and material applications.