AB52464
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $34.00 | $24.00 | - + | |
5mg | 98% | in stock | $44.00 | $31.00 | - + | |
10mg | 98% | in stock | $77.00 | $54.00 | - + | |
50mg | 98% | in stock | $226.00 | $159.00 | - + | |
250mg | 98% | in stock | $1,128.00 | $790.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52464 |
Chemical Name: | CEP-32496 |
CAS Number: | 1188910-76-0 |
Molecular Formula: | C24H22F3N5O5 |
Molecular Weight: | 517.4571896 |
MDL Number: | MFCD22124524 |
SMILES: | COc1cc2c(ncnc2cc1OC)Oc1cccc(c1)NC(=O)Nc1noc(c1)C(C(F)(F)F)(C)C |
Complexity: | 776 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 37 |
Hydrogen Bond Acceptor Count: | 11 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 5 |
Urea, N-[3-[(6,7-dimethoxy-4-quinazolinyl)oxy]phenyl]-N-[5-(2,2,2-trifluoro-1,1-dimethylethyl)-3-isoxazolyl]- is commonly utilized in chemical synthesis as a versatile building block. Its unique chemical structure enables it to participate in various reactions, allowing for the synthesis of complex organic compounds. This compound serves as a key intermediate in the production of pharmaceuticals, agrochemicals, and materials with specialized properties. In addition, its specific functional groups make it a valuable tool for creating diverse molecular architectures in the laboratory.
Journal of medicinal chemistry 20120209