logo
Home  > 7-Bromo-2,8-dimethyl-4-hydroxyquinoline

AD59417

1189106-80-6 | 7-Bromo-2,8-dimethyl-4-hydroxyquinoline

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $21.00 $15.00 -   +
250mg 95% in stock $47.00 $33.00 -   +
10g 95% in stock $1,483.00 $1,038.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD59417
Chemical Name: 7-Bromo-2,8-dimethyl-4-hydroxyquinoline
CAS Number: 1189106-80-6
Molecular Formula: C11H10BrNO
Molecular Weight: 252.1072
MDL Number: MFCD12675041
SMILES: Brc1ccc2c(c1C)[nH]c(cc2=O)C

 

Upstream Synthesis Route 
  • 7-Bromo-2,8-dimethylquinolin-4-ol is a versatile compound that finds widespread application in chemical synthesis processes. This compound serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and organic compounds. Its unique structure allows for efficient functionalization reactions, making it a key intermediate in the synthesis of complex organic molecules. Additionally, its bromine and hydroxyl groups offer diverse reactivity, enabling the formation of diverse chemical bonds and facilitating the modification of molecular properties. In chemical synthesis, 7-Bromo-2,8-dimethylquinolin-4-ol plays a crucial role in the construction of structurally intricate compounds with tailored functionalities and applications.
FEATURED PRODUCTS