AB67923
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $14.00 | $10.00 | - + | |
25g | 98% | in stock | $21.00 | $15.00 | - + | |
100g | 98% | in stock | $54.00 | $38.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB67923 |
Chemical Name: | 4-Methoxy-3-nitrotoluene |
CAS Number: | 119-10-8 |
Molecular Formula: | C8H9NO3 |
Molecular Weight: | 167.162 |
MDL Number: | MFCD25973463 |
SMILES: | COc1ccc(cc1[N+](=O)[O-])C |
4-Methoxy-3-nitrotoluene, also known as 3-Methoxy-4-nitrotoluene or NMT, is a valuable chemical compound widely used in chemical synthesis processes. This compound serves as a crucial intermediate in the production of various organic chemicals and pharmaceuticals.One key application of 4-Methoxy-3-nitrotoluene is its use as a building block in the synthesis of dyes, pigments, and pharmaceuticals. It undergoes further chemical modifications to create more complex structures with specific functional groups, allowing for the customization of desired properties in the final products. Additionally, this compound is utilized in the manufacturing of specialty chemicals and agrochemicals due to its versatile reactivity and compatibility with various reaction conditions.Furthermore, 4-Methoxy-3-nitrotoluene plays a significant role in the synthesis of liquid crystals, which are essential components in the display industry. Its unique chemical structure allows for the creation of liquid crystal materials with tunable optical and electronic properties, enabling the development of advanced display technologies.Overall, 4-Methoxy-3-nitrotoluene is a versatile compound that contributes to the advancement of various industries through its applications in chemical synthesis, paving the way for the production of innovative materials and pharmaceutical compounds.