AE09569
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
20mg | 2 weeks | $779.00 | $545.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE09569 |
Chemical Name: | MALATHIONDICARBOXYLICACID |
CAS Number: | 1190-28-9 |
Molecular Formula: | C6H11O6PS2 |
Molecular Weight: | 274.2517 |
MDL Number: | MFCD01940564 |
SMILES: | COP(=S)(SC(C(=O)O)CC(=O)O)OC |
Utilizing the multifunctional properties of Butanedioic acid, [(dimethoxyphosphinothioyl)thio]- in chemical synthesis offers a diverse array of applications across various industries. This compound serves as a crucial intermediate in the production of organic molecules, enabling the synthesis of complex structures with precision and efficiency. Its unique chemical structure, featuring phosphorus and sulfur elements, imparts distinctive properties that enhance reactivity and selectivity in the synthesis process. By integrating Butanedioic acid, [(dimethoxyphosphinothioyl)thio]- into chemical reactions, researchers can access novel pathways for creating advanced materials, pharmaceuticals, and agrochemicals, driving innovation and discovery in the field of organic chemistry.