logo
Home  > 4-(4,7-bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5- oxopntanoic Acid

BJ70031

1190101-34-8 | 4-(4,7-bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5- oxopntanoic Acid

Packsize Purity Availability Price Discounted Price    Quantity
25mg 98% in stock $147.00 $103.00 -   +
50mg 98% in stock $270.00 $189.00 -   +
100mg 98% in stock $516.00 $361.00 -   +
250mg 98% in stock $715.00 $500.00 -   +
1g 98% in stock $1,928.00 $1,349.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: BJ70031
Chemical Name: 4-(4,7-bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5- oxopntanoic Acid
CAS Number: 1190101-34-8
Molecular Formula: C27H49N3O8
Molecular Weight: 543.6933
MDL Number: MFCD01355072
SMILES: OC(=O)CCC(C(=O)OC(C)(C)C)N1CCN(CCN(CC1)CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • The 4-(4,7-bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5- oxopntanoic Acid plays a crucial role in chemical synthesis as a versatile building block for creating complex organic molecules. Its unique structure containing multiple ester and triazone functionalities makes it a valuable intermediate in the synthesis of various compounds. This compound is particularly useful in the synthesis of pharmaceuticals, agrochemicals, and materials due to its ability to participate in diverse chemical reactions, leading to the formation of novel molecules with potentially important properties.
FEATURED PRODUCTS