AA32303
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $23.00 | $16.00 | - + | |
10g | 95% | in stock | $32.00 | $22.00 | - + | |
25g | 95% | in stock | $56.00 | $39.00 | - + | |
100g | 95% | in stock | $192.00 | $134.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA32303 |
Chemical Name: | 4-[2-[(3-Ethyl-4-methyl-2-oxo-3-pyrrolin-1-yl)carboxamido]ethyl]benzenesulfonamide |
CAS Number: | 119018-29-0 |
Molecular Formula: | C16H21N3O4S |
Molecular Weight: | 351.4206 |
MDL Number: | MFCD02955393 |
SMILES: | CCC1=C(C)CN(C1=O)C(=O)NCCc1ccc(cc1)S(=O)(=O)N |
Complexity: | 628 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.2 |
The compound 4-[2-[(3-Ethyl-4-methyl-2-oxo-3-pyrrolin-1-yl)carboxamido]ethyl]benzenesulfonamide, also known as $name$, is a valuable tool in chemical synthesis. It serves as a versatile building block in the production of various organic molecules due to its unique structural features and functional groups.In chemical synthesis, $name$ is commonly used as a key intermediate in the preparation of bioactive compounds, pharmaceuticals, and agrochemicals. Its presence allows for the introduction of specific functional groups and moieties, enabling chemists to modify and manipulate the structure of the target molecule with precision.Furthermore, the sulfonamide group in $name$ provides a strong electron-withdrawing effect, making it a useful component in reactions that require electron-deficient substrates. This property can enhance the reactivity and selectivity of certain chemical transformations, ultimately facilitating the synthesis of complex molecules with high efficiency.Overall, the strategic incorporation of 4-[2-[(3-Ethyl-4-methyl-2-oxo-3-pyrrolin-1-yl)carboxamido]ethyl]benzenesulfonamide in chemical synthesis endeavors enables synthetic chemists to access a wide range of structurally diverse and functionally rich compounds for various applications in the fields of medicine, agriculture, and materials science.