AA22422
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | 2 weeks | $105.00 | $73.00 | - + | |
2mg | 95% | 2 weeks | $123.00 | $86.00 | - + | |
3mg | 95% | 2 weeks | $149.00 | $105.00 | - + | |
5mg | 95% | 2 weeks | $168.00 | $118.00 | - + | |
100mg | 95% | 2 weeks | $187.00 | $131.00 | - + | |
250mg | 95% | 2 weeks | $244.00 | $171.00 | - + | |
500mg | 95% | 2 weeks | $446.00 | $313.00 | - + | |
1g | 95% | 2 weeks | $661.00 | $463.00 | - + | |
5g | 95% | 2 weeks | $2,498.00 | $1,749.00 | - + | |
10g | 95% | 2 weeks | $4,158.00 | $2,911.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA22422 |
Chemical Name: | Methyl 5-fluoro-1h-pyrrolo[2,3-b]pyridine-4-carboxylate |
CAS Number: | 1190310-24-7 |
Molecular Formula: | C9H7FN2O2 |
Molecular Weight: | 194.1625 |
MDL Number: | MFCD12962823 |
SMILES: | COC(=O)c1c(F)cnc2c1cc[nH]2 |
Complexity: | 237 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.3 |
Methyl 5-fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate is a versatile compound widely utilized in chemical synthesis as a building block for the construction of various biologically active molecules and pharmaceuticals. This compound exhibits a unique fluorine substituent at the 5th position, offering selectivity and functionality to the molecules it is incorporated into. Its presence can enhance the potency and specificity of target compounds, making it a valuable tool in drug discovery and development. With its structural flexibility and reactivity, Methyl 5-fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate serves as a key component in the synthesis of complex organic molecules with potential applications in medicinal chemistry and agrochemical research.