AA22725
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | 1 week | $158.00 | $111.00 | - + | |
250mg | 98% | 1 week | $267.00 | $187.00 | - + | |
1g | 98% | 1 week | $721.00 | $505.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA22725 |
Chemical Name: | 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine |
CAS Number: | 1190315-61-7 |
Molecular Formula: | C8H4BrF3N2 |
Molecular Weight: | 265.03 |
MDL Number: | MFCD12962597 |
SMILES: | Brc1c[nH]c2c1cnc(c2)C(F)(F)F |
3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine plays a crucial role in chemical synthesis as a versatile building block. Its unique structure, containing both bromine and trifluoromethyl groups, makes it a valuable intermediate in the formation of complex organic molecules. This compound is commonly employed in medicinal chemistry research and pharmaceutical development due to its ability to introduce specific functional groups into target molecules. Additionally, the presence of the bromine atom allows for further functionalization through various cross-coupling reactions, enabling the creation of diverse chemical structures. In summary, the application of 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine in chemical synthesis offers a powerful tool for designing and synthesizing novel compounds with potential biological activities.