logo
Home  > 3-Bromo-7-azaindole-5-carboxylic acid methyl ester

AA23228

1190322-65-6 | 3-Bromo-7-azaindole-5-carboxylic acid methyl ester

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $55.00 $39.00 -   +
1g 95% in stock $138.00 $97.00 -   +
5g 95% in stock $415.00 $291.00 -   +
25g 95% in stock $1,957.00 $1,370.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA23228
Chemical Name: 3-Bromo-7-azaindole-5-carboxylic acid methyl ester
CAS Number: 1190322-65-6
Molecular Formula: C9H7BrN2O2
Molecular Weight: 255.0681
MDL Number: MFCD12962903
SMILES: COC(=O)c1cc2c(Br)c[nH]c2nc1

 

Upstream Synthesis Route 
  • Methyl 3-bromo-1H-pyrrolo[2,3-b]pyridine-5-carboxylate serves as a versatile building block in chemical synthesis, particularly in the field of medicinal chemistry. Its strategic bromine substitution and pyrrolopyridine core make it a valuable intermediate in the development of pharmaceutical compounds. This compound's unique structure allows for various functionalization reactions, enabling the introduction of diverse chemical moieties for the creation of novel drug candidates. Additionally, its presence in molecular structures often imparts desirable properties, such as improved bioavailability or target specificity, enhancing the potential therapeutic value of the final products.
FEATURED PRODUCTS