AA23358
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $65.00 | $45.00 | - + | |
1g | 97% | in stock | $155.00 | $108.00 | - + | |
5g | 97% | in stock | $573.00 | $402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA23358 |
Chemical Name: | 4,7-Dibromo-5,6-bis(hexyloxy)-2,1,3-benzothiadiazole, |
CAS Number: | 1190978-94-9 |
Molecular Formula: | C18H26Br2N2O2S |
Molecular Weight: | 494.2842 |
MDL Number: | MFCD28053756 |
SMILES: | CCCCCCOc1c(OCCCCCC)c(Br)c2c(c1Br)nsn2 |
Complexity: | 336 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 12 |
XLogP3: | 7.8 |
4,7-Dibromo-5,6-bis(hexyloxy)benzo[c][1,2,5]thiadiazole is a versatile compound commonly utilized in chemical synthesis. This compound plays a crucial role as a core building block in the development of novel organic materials and polymers. In the field of organic electronics, 4,7-Dibromo-5,6-bis(hexyloxy)benzo[c][1,2,5]thiadiazole is frequently employed to construct semiconductor materials for use in organic photovoltaic (OPV) devices.The unique chemical structure of 4,7-Dibromo-5,6-bis(hexyloxy)benzo[c][1,2,5]thiadiazole offers exceptional electron-accepting properties, making it an ideal candidate for enhancing the performance of optoelectronic devices. By incorporating this compound into the molecular design of conjugated polymers, researchers can tailor the optical and electronic properties to achieve desired characteristics such as high charge carrier mobility and improved energy conversion efficiency.Furthermore, the functional groups present in 4,7-Dibromo-5,6-bis(hexyloxy)benzo[c][1,2,5]thiadiazole enable facile modification and fine-tuning of its chemical properties, allowing for the synthesis of customized materials with specific functionalities. This versatility makes 4,7-Dibromo-5,6-bis(hexyloxy)benzo[c][1,2,5]thiadiazole a valuable tool in the design and development of advanced organic semiconductors for various technological applications.