AA23355
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 96% | in stock | $35.00 | $24.00 | - + | |
250mg | 96% | in stock | $58.00 | $41.00 | - + | |
1g | 96% | in stock | $149.00 | $105.00 | - + | |
10g | 96% | in stock | $1,317.00 | $922.00 | - + | |
25g | 96% | in stock | $2,623.00 | $1,836.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA23355 |
Chemical Name: | 3,5-Difluoro-4-(methoxycarbonyl)phenylboronic acid |
CAS Number: | 1190989-09-3 |
Molecular Formula: | C8H7BF2O4 |
Molecular Weight: | 215.9466 |
MDL Number: | MFCD16295262 |
SMILES: | COC(=O)c1c(F)cc(cc1F)B(O)O |
Complexity: | 227 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
(3,5-Difluoro-4-(methoxycarbonyl)phenyl)boronic acid is a valuable chemical reagent used in organic synthesis processes for the preparation of various pharmaceuticals and agrochemicals. This compound serves as a key building block due to its boronic acid functionality, which enables it to participate in Suzuki-Miyaura cross-coupling reactions with aryl halides or pseudohalides. By forming C-C bonds in these coupling reactions, it facilitates the incorporation of the (3,5-difluoro-4-(methoxycarbonyl)phenyl)boronic acid moiety into more complex molecular structures.Moreover, the presence of both fluoro and methoxycarbonyl functional groups in this compound provides opportunities for further derivatization and diversification of chemical structures. These functional groups can undergo various transformations such as nucleophilic substitution, reduction, or oxidation reactions to introduce additional substituents or modify the electronic properties of the molecule. Consequently, the versatility of (3,5-Difluoro-4-(methoxycarbonyl)phenyl)boronic acid makes it a versatile tool in the synthesis of biologically active compounds with tailored properties for specific applications.