AA23366
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 80% | in stock | $35.00 | $25.00 | - + | |
250mg | 80% | in stock | $58.00 | $41.00 | - + | |
1g | 80% | in stock | $62.00 | $44.00 | - + | |
5g | 80% | in stock | $153.00 | $107.00 | - + | |
25g | 80% | in stock | $454.00 | $318.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA23366 |
Chemical Name: | Linolenic Acid Ethyl Ester |
CAS Number: | 1191-41-9 |
Molecular Formula: | C20H34O2 |
Molecular Weight: | 306.4827600000001 |
MDL Number: | MFCD01731117 |
SMILES: | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCC |
NSC Number: | 607760 |
Complexity: | 327 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 3 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 15 |
XLogP3: | 6.6 |
Lipids 20091001
The Journal of pediatrics 20080601
Se pu = Chinese journal of chromatography 20070501
Journal of agricultural and food chemistry 20040602
Life sciences 20030718
Journal of agricultural and food chemistry 20030101
Alcohol and alcoholism (Oxford, Oxfordshire) 20020101