logo
Home  > 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole

AA23625

1192056-62-4 | 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $265.00 $186.00 -   +
250mg 95% in stock $595.00 $417.00 -   +
1g 95% in stock $1,558.00 $1,091.00 -   +
5g 95% in stock $7,550.00 $5,285.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA23625
Chemical Name: 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole
CAS Number: 1192056-62-4
Molecular Formula: C10H16BNO3
Molecular Weight: 209.0499
MDL Number: MFCD10697443
SMILES: Cc1ncc(o1)B1OC(C(O1)(C)C)(C)C

 

Upstream Synthesis Route
  • 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole, commonly referred to as $name$, is a versatile compound widely used in chemical synthesis. This compound plays a crucial role in various organic reactions, particularly in the field of cross-coupling chemistry.One of the primary applications of 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole is as a boronic ester reagent in palladium-catalyzed cross-coupling reactions. This compound serves as a valuable substrate for Suzuki-Miyaura coupling reactions, enabling the formation of carbon-carbon bonds in a selective and efficient manner. The presence of the boronic ester group allows for the introduction of functionalized aryl or heteroaryl groups into a desired molecular scaffold, making it an essential building block in the synthesis of complex organic molecules.Furthermore, the unique structure of 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole imparts enhanced stability and reactivity, making it a preferred choice for chemists involved in the development of pharmaceuticals, agrochemicals, and materials science. Its compatibility with a wide range of substrates and reaction conditions further enhances its utility in modern organic synthesis.In summary, 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole is a key reagent in chemical synthesis, particularly in palladium-catalyzed cross-coupling reactions, offering chemists an invaluable tool for the construction of complex organic molecules with high precision and efficiency.
FEATURED PRODUCTS