AX03815
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $80.00 | $56.00 | - + | |
250mg | 97% | in stock | $136.00 | $95.00 | - + | |
1g | 97% | in stock | $360.00 | $252.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX03815 |
Chemical Name: | (R)-2-Amino-2-(naphthalen-1-yl)acetic acid hydrochloride |
CAS Number: | 1192350-47-2 |
Molecular Formula: | C12H12ClNO2 |
Molecular Weight: | 237.6822 |
MDL Number: | MFCD30749197 |
SMILES: | OC(=O)[C@@H](c1cccc2c1cccc2)N.Cl |
Complexity: | 242 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
The (R)-2-Amino-2-(naphthalen-1-yl)acetic acid hydrochloride is a crucial compound widely utilized in chemical synthesis as a versatile building block. Its unique molecular structure and reactivity make it indispensable in the creation of a variety of complex chemical compounds. Due to its chiral nature, this compound plays a significant role in asymmetric synthesis, enabling the production of enantiopure organic molecules with high stereoselectivity. Additionally, its presence as a key component in peptide synthesis and pharmaceutical research highlights its importance in the development of novel drug candidates and bioactive molecules. The (R)-2-Amino-2-(naphthalen-1-yl)acetic acid hydrochloride serves as a valuable tool for chemists and researchers alike, facilitating the advancement of synthetic chemistry and the exploration of new frontiers in chemical science.