AZ99432
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | 1 week | $97.00 | $68.00 | - + | |
250mg | 98% | 1 week | $160.00 | $112.00 | - + | |
1g | 98% | 1 week | $473.00 | $331.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AZ99432 |
Chemical Name: | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-ureidopropanoic acid |
CAS Number: | 1192601-91-4 |
Molecular Formula: | C19H19N3O5 |
Molecular Weight: | 369.3713 |
MDL Number: | MFCD02682428 |
SMILES: | NC(=O)NC[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2-c2c1cccc2 |
FMOC-ALB-OH is a crucial tool in chemical synthesis, particularly in the field of peptide synthesis. This compound serves as a versatile building block for constructing complex peptides and proteins with high purity and precision. Its FMOC (9-fluorenylmethoxycarbonyl) protecting group allows for sequential deprotection and coupling steps, enabling the stepwise assembly of peptide chains. Additionally, FMOC-ALB-OH's Alb-protected amino group offers enhanced stability during synthesis, preventing premature side reactions and ensuring optimal yield. With its reliable performance and compatibility with various peptide coupling reagents, FMOC-ALB-OH is indispensable in the creation of custom peptides for research, pharmaceutical development, and bioengineering applications.