logo
Home  > Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, (1R,2R,4R)-rel-

AA24276

1195-12-6 | Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, (1R,2R,4R)-rel-

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $34.00 $24.00 -   +
5g 95% in stock $74.00 $52.00 -   +
25g 95% in stock $203.00 $142.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA24276
Chemical Name: Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, (1R,2R,4R)-rel-
CAS Number: 1195-12-6
Molecular Formula: C8H10O2
Molecular Weight: 138.1638
MDL Number: MFCD08686916
SMILES: OC(=O)[C@@H]1C[C@H]2C[C@@H]1C=C2

 

Upstream Synthesis Route 
  • The (1R,2R,4R)-Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid is a versatile compound widely used in chemical synthesis. As a chiral building block, it plays a crucial role in the creation of asymmetric molecules with specific stereochemistry. This compound can be utilized in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals where stereochemistry is a key factor in their biological activity or functionality. Additionally, it can serve as a starting material for the preparation of complex organic molecules through strategic bond formations, such as cyclizations, oxidations, reductions, and functional group manipulations. Its unique bicyclic structure imparts distinct reactivity, making it a valuable tool for chemists in designing and synthesizing new compounds with desired stereochemical outcomes.
FEATURED PRODUCTS