AA24356
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $18.00 | $12.00 | - + | |
250mg | 97% | in stock | $26.00 | $18.00 | - + | |
1g | 97% | in stock | $42.00 | $30.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA24356 |
Chemical Name: | L-3-Chlorophenylglycine |
CAS Number: | 119565-00-3 |
Molecular Formula: | C8H8ClNO2 |
Molecular Weight: | 185.6076 |
MDL Number: | MFCD03839814 |
SMILES: | OC(=O)[C@H](c1cccc(c1)Cl)N |
Complexity: | 174 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | -1.1 |
(S)-2-Amino-2-(3-chlorophenyl)acetic acid, also known as $name$, is a valuable chiral building block frequently used in chemical synthesis. Its primary application lies in asymmetric synthesis, where its chiral nature allows for the creation of enantiomerically pure compounds. This compound serves as a key intermediate in the production of pharmaceuticals, agrochemicals, and materials with specific optical properties. By incorporating (S)-2-Amino-2-(3-chlorophenyl)acetic acid into synthetic routes, chemists can efficiently access a wide variety of enantioenriched molecules, thereby enabling the development of new drugs, materials, and biologically active compounds.