AA24378
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 98% | in stock | $15.00 | $10.00 | - + | |
25mg | 98% | in stock | $22.00 | $15.00 | - + | |
50mg | 98% | in stock | $33.00 | $23.00 | - + | |
100mg | 98% | in stock | $58.00 | $40.00 | - + | |
250mg | 98% | in stock | $126.00 | $88.00 | - + | |
1g | 98% | in stock | $378.00 | $264.00 | - + | |
5g | 98% | in stock | $1,505.00 | $1,054.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA24378 |
Chemical Name: | Dabrafenib mesylate |
CAS Number: | 1195768-06-9 |
Molecular Formula: | C24H24F3N5O5S3 |
Molecular Weight: | 615.6681 |
MDL Number: | MFCD20922872 |
SMILES: | CS(=O)(=O)O.Nc1nccc(n1)c1sc(nc1c1cccc(c1F)NS(=O)(=O)c1c(F)cccc1F)C(C)(C)C |
Complexity: | 910 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 40 |
Hydrogen Bond Acceptor Count: | 14 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
The compound $name$ plays a crucial role in chemical synthesis as a versatile building block and intermediate. With its unique structure, it serves as a key component in the development of various pharmaceuticals and agrochemicals. Its application in chemical synthesis arises from its ability to participate in a range of reactions, enabling the creation of diverse molecular structures. By incorporating $name$ into synthetic pathways, chemists can access complex compounds more efficiently and yield compounds with enhanced properties. This compound's strategic placement of functional groups makes it a valuable tool in the hands of synthetic chemists striving to unlock new possibilities in drug discovery and materials science.