AA32635
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $350.00 | $245.00 | - + | |
250mg | 95% | in stock | $629.00 | $440.00 | - + | |
1g | 95% | in stock | $1,188.00 | $831.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA32635 |
Chemical Name: | tert-Butyl 6-(aminomethyl)-3,4-dihydroisoquinoline-2(1h)-carboxylate |
CAS Number: | 1196154-55-8 |
Molecular Formula: | C15H22N2O2 |
Molecular Weight: | 262.3474 |
MDL Number: | MFCD09038211 |
SMILES: | NCc1ccc2c(c1)CCN(C2)C(=O)OC(C)(C)C |
Complexity: | 325 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.5 |
The tert-Butyl 6-(aminomethyl)-3,4-dihydroisoquinoline-2(1H)-carboxylate is a versatile compound commonly used in chemical synthesis. Its unique structure allows for a variety of applications in organic chemistry, particularly in the field of drug development and materials science.One of the key applications of tert-Butyl 6-(aminomethyl)-3,4-dihydroisoquinoline-2(1H)-carboxylate is as a building block in the synthesis of bioactive molecules and pharmaceutical compounds. By incorporating this compound into a synthesis pathway, chemists can introduce specific functionalities and stereochemistry necessary for the desired pharmacological activity. This compound's presence in the chemical structure can enhance the compound's bioavailability, increase its stability, or modulate its activity.In addition to its role in drug development, tert-Butyl 6-(aminomethyl)-3,4-dihydroisoquinoline-2(1H)-carboxylate can also be utilized in the synthesis of advanced materials. Its unique structure and reactivity make it a valuable precursor for designing novel polymers, catalysts, and functionalized surfaces. By incorporating this compound into polymerization reactions or surface modification processes, researchers can tailor the properties of the resulting materials for specific applications such as sensors, coatings, or drug delivery systems.Overall, the tert-Butyl 6-(aminomethyl)-3,4-dihydroisoquinoline-2(1H)-carboxylate plays a crucial role in chemical synthesis by enabling the construction of complex molecules with tailored properties. Its versatility and functionality make it a valuable tool for advancing research in various fields of chemistry.