logo
Home  > tert-Butyl 5-(aminomethyl)-1,2,3,4-tetrahydroisoquinoline-2-carboxylate

AW33659

1196156-49-6 | tert-Butyl 5-(aminomethyl)-1,2,3,4-tetrahydroisoquinoline-2-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
50mg 92% 3 weeks $933.00 $653.00 -   +
100mg 92% 3 weeks $1,280.00 $896.00 -   +
250mg 92% 3 weeks $1,734.00 $1,214.00 -   +
500mg 92% 3 weeks $2,595.00 $1,817.00 -   +
1g 92% 3 weeks $3,264.00 $2,285.00 -   +
2.5g 92% 3 weeks $6,174.00 $4,322.00 -   +
5g 92% 3 weeks $9,026.00 $6,319.00 -   +
10g 92% 3 weeks $13,274.00 $9,292.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AW33659
Chemical Name: tert-Butyl 5-(aminomethyl)-1,2,3,4-tetrahydroisoquinoline-2-carboxylate
CAS Number: 1196156-49-6
Molecular Formula: C15H22N2O2
Molecular Weight: 262.3474
MDL Number: MFCD13190056
SMILES: NCc1cccc2c1CCN(C2)C(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • The tert-Butyl 5-(Aminomethyl)-1,2,3,4-tetrahydroisoquinoline-2-carboxylate is a versatile compound widely used in chemical synthesis. In organic chemistry, it serves as a valuable building block for the preparation of various biologically active compounds. This compound is often employed in the synthesis of pharmaceuticals, agrochemicals, and materials science due to its unique structure and reactivity. Its presence in the molecular structure of target compounds can impart specific properties or functionalities that are crucial for their intended applications. Additionally, the tert-Butyl 5-(Aminomethyl)-1,2,3,4-tetrahydroisoquinoline-2-carboxylate plays a significant role in research and development efforts aimed at designing novel molecules with enhanced therapeutic or industrial potential.
FEATURED PRODUCTS