1196156-55-4 | tert-Butyl (6-formylpyridin-3-yl)carbamate

Packsize	Purity	Availability	Price	Discounted Price
100mg	95%	in stock	$184.00	$129.00
250mg	95%	in stock	$312.00	$218.00

Description

• Catalog Number: BD63140
• Chemical Name: tert-Butyl (6-formylpyridin-3-yl)carbamate
• CAS Number: 1196156-55-4
• Molecular Formula: C11H14N2O3
• Molecular Weight: 222.2405
• MDL Number: MFCD13190064
• SMILES: O=Cc1ccc(cn1)NC(=O)OC(C)(C)C

Upstream Synthesis Route

1,1-Dimethylethyl N-(6-formyl-3-pyridinyl)carbamate is a versatile compound widely used in chemical synthesis for its unique properties and reactivity. This compound serves as a key building block in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. It plays a crucial role in the design and synthesis of new drug candidates, particularly in the field of medicinal chemistry.In chemical synthesis, 1,1-Dimethylethyl N-(6-formyl-3-pyridinyl)carbamate acts as a valuable intermediate in the formation of biologically active molecules. Its functional groups offer a high degree of synthetic flexibility, allowing for efficient manipulation and modification to introduce specific properties or enhance desired biological activities. This compound serves as a key starting material for the incorporation of pyridine and carbamate moieties into complex molecular structures, enabling the development of innovative compounds with tailored pharmacological profiles.Furthermore, the controlled transformation of 1,1-Dimethylethyl N-(6-formyl-3-pyridinyl)carbamate in chemical reactions allows for the selective formation of various functional groups, enabling chemists to access a diverse array of structurally diverse compounds with potential therapeutic applications. Its ability to undergo various transformations, such as reduction, oxidation, and substitution reactions, makes it a valuable tool for organic chemists seeking to design and synthesize novel compounds with improved biological activities or physicochemical properties.