AD74994
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 98% | in stock | $179.00 | $125.00 | - + | |
50mg | 98% | in stock | $295.00 | $207.00 | - + | |
100mg | 98% | in stock | $509.00 | $357.00 | - + | |
250mg | 98% | in stock | $1,144.00 | $801.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD74994 |
Chemical Name: | Sulpho NHS biotin |
CAS Number: | 119616-38-5 |
Molecular Formula: | C14H18N3NaO8S2 |
Molecular Weight: | 443.4278 |
MDL Number: | MFCD00078535 |
SMILES: | O=C(ON1C(=O)CC(C1=O)S(=O)(=O)[O-])CCCCC1SC[C@H]2[C@@H]1NC(=O)N2.[Na+] |
Biotin 3-sulfo-N-hydroxysuccinimide ester sodium salt is a valuable reagent in chemical synthesis, particularly in the field of bioconjugation. This compound is commonly used to introduce biotin molecules onto target molecules, enabling the selective binding of biotinylated compounds to avidin or streptavidin for various applications. In chemical synthesis, Biotin 3-sulfo-N-hydroxysuccinimide ester sodium salt plays a key role in the creation of biotinylated probes, biomolecular labeling, and the development of bioassays. Its ability to form stable covalent bonds with primary amines makes it an essential tool for researchers working in biochemistry, molecular biology, and biotechnology. By facilitating the specific attachment of biotin tags to a wide range of molecules, this reagent enables the precise tracking, isolation, and manipulation of biomolecules in diverse experimental settings.