AE49819
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE49819 |
Chemical Name: | (E)-carveol,(E)-p-mentha-6,8-dien-2-ol,trans-1-methyl-4-isoprpenyl-6-cyclohexen-2-ol |
CAS Number: | 1197-07-5 |
Molecular Formula: | C15H29NO4 |
Molecular Weight: | 287.3951 |
SMILES: | N[C@H]([C@H]([C@@H]([C@H](C(=O)O)C(C)C)O)O)CC1CCCCC1 |
The versatile compound (±)-trans-Carveol serves as a valuable building block in chemical synthesis, enabling the creation of a wide range of products across various industries. With its unique structure and properties, (±)-trans-Carveol finds utility in the synthesis of pharmaceuticals, fragrances, and flavoring agents. As a key intermediate, it facilitates the production of complex organic compounds through various synthetic routes, contributing to the advancement of modern chemistry and the development of innovative products in the market.