AA32897
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $46.00 | $32.00 | - + | |
1g | 95% | in stock | $88.00 | $62.00 | - + | |
5g | 95% | in stock | $323.00 | $226.00 | - + | |
10g | 95% | in stock | $511.00 | $358.00 | - + | |
25g | 95% | in stock | $1,008.00 | $706.00 | - + | |
100g | 95% | in stock | $2,625.00 | $1,837.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA32897 |
Chemical Name: | 1-[4-Bromo-2-(trifluoromethyl)phenyl]ethan-1-one |
CAS Number: | 1197231-94-9 |
Molecular Formula: | C9H6BrF3O |
Molecular Weight: | 267.0425 |
MDL Number: | MFCD16839140 |
SMILES: | Brc1ccc(c(c1)C(F)(F)F)C(=O)C |
Complexity: | 227 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.2 |
1-(4-Bromo-2-(trifluoromethyl)phenyl)ethanone is a versatile chemical compound widely used in organic synthesis for its unique properties. It plays a crucial role as a key starting material in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. Due to its functional groups, this compound can undergo a variety of reactions, such as nucleophilic addition, substitution, and aromatic substitution, making it an essential building block in the creation of complex organic molecules. Its use in chemical synthesis extends to the development of new materials, dyes, and polymers, showcasing its importance in the field of organic chemistry.