AA32996
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $29.00 | $21.00 | - + | |
250mg | 95% | in stock | $48.00 | $34.00 | - + | |
500mg | 95% | in stock | $69.00 | $48.00 | - + | |
1g | 95% | in stock | $98.00 | $68.00 | - + | |
5g | 95% | in stock | $415.00 | $291.00 | - + | |
25g | 95% | in stock | $1,879.00 | $1,316.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA32996 |
Chemical Name: | 3-(2-Chlorophenyl)-1h-pyrazole-5-carboxylic acid |
CAS Number: | 1197631-00-7 |
Molecular Formula: | C10H7ClN2O2 |
Molecular Weight: | 222.6278 |
MDL Number: | MFCD05170018 |
SMILES: | Clc1ccccc1c1[nH]nc(c1)C(=O)O |
Complexity: | 250 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.4 |
Bioorganic & medicinal chemistry letters 20090101
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501