AX26199
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $33.00 | $23.00 | - + | |
2mg | 98% | in stock | $55.00 | $39.00 | - + | |
5mg | 98% | in stock | $67.00 | $47.00 | - + | |
10mg | 98% | in stock | $83.00 | $58.00 | - + | |
25mg | 98% | in stock | $119.00 | $84.00 | - + | |
50mg | 98% | in stock | $179.00 | $125.00 | - + | |
100mg | 98% | in stock | $216.00 | $151.00 | - + | |
250mg | 98% | in stock | $360.00 | $252.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX26199 |
Chemical Name: | N-[2-(4-ETHOXYPHENOXY)PHENYL]-4-[(PROP-2-ENOYLAMINO)METHYL]BENZAMIDE |
CAS Number: | 1197824-15-9 |
Molecular Formula: | C25H24N2O4 |
Molecular Weight: | 416.4691 |
MDL Number: | MFCD13582116 |
SMILES: | CCOc1ccc(cc1)Oc1ccccc1NC(=O)c1ccc(cc1)CNC(=O)C=C |
N-[2-(4-Ethoxyphenoxy)phenyl]-4-[[(1-oxo-2-propen-1-yl)amino]methyl]benzamide can be utilized as a versatile building block in chemical synthesis processes. Its unique structure and functional groups make it a valuable intermediate for designing and creating various organic compounds with specific properties and functionalities. This compound can be used as a key component in the synthesis of pharmaceuticals, agrochemicals, and materials with advanced applications. Its presence in a reaction mixture can facilitate the formation of complex molecular structures through strategic bond formations and functional group manipulations. Additionally, its role in coupling reactions and cross-coupling reactions leads to the generation of structurally diverse molecules with enhanced chemical reactivity and biological activity.