AA33047
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $6.00 | $4.00 | - + | |
2mg | 98% | in stock | $8.00 | $6.00 | - + | |
5mg | 98% | in stock | $10.00 | $7.00 | - + | |
10mg | 98% | in stock | $12.00 | $9.00 | - + | |
100mg | 98% | in stock | $38.00 | $26.00 | - + | |
1g | 98% | in stock | $73.00 | $51.00 | - + | |
5g | 98% | in stock | $127.00 | $89.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA33047 |
Chemical Name: | Brigatinib |
CAS Number: | 1197953-54-0 |
Molecular Formula: | C29H39ClN7O2P |
Molecular Weight: | 584.0924 |
MDL Number: | MFCD29472221 |
SMILES: | COc1cc(ccc1Nc1ncc(c(n1)Nc1ccccc1P(=O)(C)C)Cl)N1CCC(CC1)N1CCN(CC1)C |
Complexity: | 835 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 40 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 8 |
XLogP3: | 4.6 |
Journal of medicinal chemistry 20160526
Proceedings of the National Academy of Sciences of the United States of America 20110503