AA33054
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | in stock | $16.00 | $11.00 | - + | ||
1g | in stock | $23.00 | $17.00 | - + | ||
5g | in stock | $81.00 | $57.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA33054 |
Chemical Name: | Tetrachlorocatechol |
CAS Number: | 1198-55-6 |
Molecular Formula: | C6H2Cl4O2 |
Molecular Weight: | 247.8909 |
MDL Number: | MFCD00002190 |
SMILES: | Oc1c(O)c(Cl)c(c(c1Cl)Cl)Cl |
NSC Number: | 29027 |
Complexity: | 150 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
XLogP3: | 4.3 |
Inorganic chemistry 20121015
Journal of hazardous materials 20100815
Archives of toxicology 20100501
Environmental science & technology 20100415
Inorganic chemistry 20100405
Inorganic chemistry 20100301
Toxicology 20100209
Toxicology letters 20091215
Inorganic chemistry 20090817
Environmental toxicology and chemistry 20090701
Journal of hazardous materials 20090130
Inorganic chemistry 20080818
Chemistry (Weinheim an der Bergstrasse, Germany) 20080101
Inorganic chemistry 20071001
Environmental toxicology and chemistry 20061101
Huan jing ke xue= Huanjing kexue 20060701
Organic letters 20060330
The Journal of organic chemistry 20060203
Chemical research in toxicology 20050201
Biodegradation 20041001
Inorganic chemistry 20031006
Applied microbiology and biotechnology 20030801
Chemosphere 20030601
Inorganic chemistry 20030324
Inorganic chemistry 20020729
Drug metabolism and disposition: the biological fate of chemicals 20020201
Molecular pharmacology 20010201
Journal of bacteriology 20010201
Toxicology in vitro : an international journal published in association with BIBRA 20010201
Environmental toxicology and chemistry 20010201
Applied and environmental microbiology 19991201
The Journal of antibiotics 19980901