AA33185
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $65.00 | $45.00 | - + | |
250mg | 95% | in stock | $156.00 | $109.00 | - + | |
1g | 95% | in stock | $365.00 | $255.00 | - + | |
5g | 95% | in stock | $933.00 | $653.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA33185 |
Chemical Name: | (S)-tert-Butyl 2-(tert-butyl)-3-methyl-4-oxoimidazolidine-1-carboxylate |
CAS Number: | 119838-38-9 |
Molecular Formula: | C13H24N2O3 |
Molecular Weight: | 256.3413 |
MDL Number: | MFCD00075101 |
SMILES: | O=C(N1CC(=O)N([C@@H]1C(C)(C)C)C)OC(C)(C)C |
Complexity: | 352 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.3 |
(S)-(-)-1-Boc-2-tert-butyl-3-methyl-4-imidazolidinone is a valuable chiral building block widely used in chemical synthesis. Its unique structure and chirality make it a versatile tool for asymmetric transformations and the synthesis of complex organic molecules. In particular, this compound is utilized as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and fine chemicals. Its Boc (tert-butoxycarbonyl) protection group can be selectively removed under mild conditions, allowing for further functionalization at the nitrogen atom. Additionally, the tert-butyl and methyl substituents on the imidazolidinone ring provide steric hindrance that is crucial for controlling diastereoselectivity in organic reactions. Overall, (S)-(-)-1-Boc-2-tert-butyl-3-methyl-4-imidazolidinone plays a pivotal role in modern organic synthesis, enabling chemists to access enantiomerically pure compounds with high selectivity and efficiency.