AA33172
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $23.00 | $16.00 | - + | |
1g | 95% | in stock | $26.00 | $19.00 | - + | |
5g | 95% | in stock | $129.00 | $91.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA33172 |
Chemical Name: | tert-Butyl 4-(6-aminopyridin-3-yl)piperidine-1-carboxylate |
CAS Number: | 1198408-35-3 |
Molecular Formula: | C15H23N3O2 |
Molecular Weight: | 277.36202000000003 |
MDL Number: | MFCD11111266 |
SMILES: | O=C(N1CCC(CC1)c1ccc(nc1)N)OC(C)(C)C |
Complexity: | 333 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.9 |
The tert-Butyl 4-(6-aminopyridin-3-yl)piperidine-1-carboxylate is a valuable compound in chemical synthesis due to its versatile applications. It serves as a key intermediate in the preparation of novel pharmaceutical compounds, particularly in the development of potential therapeutics targeting specific biological pathways. This compound plays a crucial role in the construction of molecular scaffolds, enabling the synthesis of diverse derivatives with enhanced pharmacological properties. Additionally, its unique structure and reactivity make it a valuable building block for the creation of complex molecules, facilitating the exploration of new chemical space in drug discovery efforts.