AA33212
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 97% | in stock | $20.00 | $14.00 | - + | |
100g | 97% | in stock | $46.00 | $32.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA33212 |
Chemical Name: | 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one |
CAS Number: | 119851-28-4 |
Molecular Formula: | C14H10Cl2O2 |
Molecular Weight: | 281.134 |
MDL Number: | MFCD00140226 |
SMILES: | Clc1ccc(cc1)Oc1ccc(c(c1)Cl)C(=O)C |
Complexity: | 288 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 4.6 |
1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one is a versatile compound commonly used in chemical synthesis as a key building block. Its unique structure allows for the introduction of diverse functional groups, making it an important intermediate in the production of various pharmaceuticals, agrochemicals, and advanced materials. In organic synthesis, this compound serves as a valuable starting material for the preparation of complex molecules with specific properties and functionalities. With its ability to undergo various chemical reactions, 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one plays a crucial role in the development of new compounds for a wide range of applications.