logo
Home  > Chemistry  > Organic Building Blocks  > Ketones  > 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one

AA33212

119851-28-4 | 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one

Packsize Purity Availability Price Discounted Price    Quantity
25g 97% in stock $20.00 $14.00 -   +
100g 97% in stock $46.00 $32.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA33212
Chemical Name: 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one
CAS Number: 119851-28-4
Molecular Formula: C14H10Cl2O2
Molecular Weight: 281.134
MDL Number: MFCD00140226
SMILES: Clc1ccc(cc1)Oc1ccc(c(c1)Cl)C(=O)C

 

Computed Properties
Complexity: 288  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 18  
Hydrogen Bond Acceptor Count: 2  
Rotatable Bond Count: 3  
XLogP3: 4.6  

 

 

Upstream Synthesis Route
  • 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one is a versatile compound commonly used in chemical synthesis as a key building block. Its unique structure allows for the introduction of diverse functional groups, making it an important intermediate in the production of various pharmaceuticals, agrochemicals, and advanced materials. In organic synthesis, this compound serves as a valuable starting material for the preparation of complex molecules with specific properties and functionalities. With its ability to undergo various chemical reactions, 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one plays a crucial role in the development of new compounds for a wide range of applications.
FEATURED PRODUCTS