logo
Home  > Fmoc-d-cys(mmt)-oh

AE09194

1198791-73-9 | Fmoc-d-cys(mmt)-oh

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $45.00 $31.00 -   +
1g 95% in stock $82.00 $57.00 -   +
5g 95% in stock $235.00 $165.00 -   +
10g 95% in stock $458.00 $320.00 -   +
25g 95% in stock $752.00 $527.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE09194
Chemical Name: Fmoc-d-cys(mmt)-oh
CAS Number: 1198791-73-9
Molecular Formula: C38H33NO5S
Molecular Weight: 615.7373
MDL Number: MFCD02094091
SMILES: COc1ccc(cc1)C(c1ccccc1)(c1ccccc1)SC[C@H](C(=O)O)NC(=O)OCC1c2ccccc2-c2c1cccc2

 

Upstream Synthesis Route
  • Fmoc-D-Cys(Mmt)-OH, also known as N-[(9-Fluorenylmethoxycarbonyl)-D-cysteine]-Mmt-OH, is a key building block in peptide chemistry and organic synthesis. This compound is widely used for the solid-phase synthesis of peptides due to its ability to protect the thiol group in the cysteine residue.In chemical synthesis, the Fmoc-D-Cys(Mmt)-OH molecule serves as a crucial component for introducing cysteine residues into peptide chains. By utilizing the Fmoc (9-Fluorenylmethoxycarbonyl) protecting group, the thiol group of cysteine is shielded from unwanted side reactions, allowing for selective deprotection and subsequent functionalization during peptide assembly. The Mmt (4-Methoxytrityl) protection group on the amino group ensures further protection and controlled reactivity.Overall, Fmoc-D-Cys(Mmt)-OH plays a pivotal role in the precise and efficient synthesis of peptides, enabling the construction of complex peptide structures with specific cysteine residues in a controlled manner. Its strategic incorporation in peptide synthesis allows for the production of tailor-made peptides for various biomedical, pharmaceutical, and chemical research applications.
FEATURED PRODUCTS