AA33376
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $73.00 | $51.00 | - + | |
5g | 97% | in stock | $201.00 | $141.00 | - + | |
25g | 97% | in stock | $572.00 | $400.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA33376 |
Chemical Name: | Ethyl 2-(2,3-dichlorophenyl)-2,2-difluoroacetate |
CAS Number: | 1199773-04-0 |
Molecular Formula: | C10H8Cl2F2O2 |
Molecular Weight: | 269.0721 |
MDL Number: | MFCD13195686 |
SMILES: | CCOC(=O)C(c1cccc(c1Cl)Cl)(F)F |
Complexity: | 261 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 4 |
XLogP3: | 4.1 |
Ethyl 2-(2,3-dichlorophenyl)-2,2-difluoroacetate is a versatile compound that finds application as a key intermediate in organic chemical synthesis. Due to its unique structural properties, this compound serves as a valuable building block in the preparation of various pharmaceuticals, agrochemicals, and advanced materials. Its reactivity and functionality make it a crucial component in the development of novel chemical entities and the modification of existing molecules for specific purposes in the field of medicinal chemistry and material science. Specifically, this compound can participate in a variety of reactions such as esterification, nucleophilic substitution, and cross-coupling reactions, enabling the synthesis of complex organic molecules with tailored properties and functionalities. Its incorporation in the synthesis of target compounds offers chemists a strategic pathway to access diverse chemical space for the discovery and development of new compounds with potential applications in various industries.