logo
Home  > Ethyl 2-(2,3-dichlorophenyl)-2,2-difluoroacetate

AA33376

1199773-04-0 | Ethyl 2-(2,3-dichlorophenyl)-2,2-difluoroacetate

Packsize Purity Availability Price Discounted Price    Quantity
1g 97% in stock $73.00 $51.00 -   +
5g 97% in stock $201.00 $141.00 -   +
25g 97% in stock $572.00 $400.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA33376
Chemical Name: Ethyl 2-(2,3-dichlorophenyl)-2,2-difluoroacetate
CAS Number: 1199773-04-0
Molecular Formula: C10H8Cl2F2O2
Molecular Weight: 269.0721
MDL Number: MFCD13195686
SMILES: CCOC(=O)C(c1cccc(c1Cl)Cl)(F)F

 

Computed Properties
Complexity: 261  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 16  
Hydrogen Bond Acceptor Count: 4  
Rotatable Bond Count: 4  
XLogP3: 4.1  

 

 

Upstream Synthesis Route
  • Ethyl 2-(2,3-dichlorophenyl)-2,2-difluoroacetate is a versatile compound that finds application as a key intermediate in organic chemical synthesis. Due to its unique structural properties, this compound serves as a valuable building block in the preparation of various pharmaceuticals, agrochemicals, and advanced materials. Its reactivity and functionality make it a crucial component in the development of novel chemical entities and the modification of existing molecules for specific purposes in the field of medicinal chemistry and material science. Specifically, this compound can participate in a variety of reactions such as esterification, nucleophilic substitution, and cross-coupling reactions, enabling the synthesis of complex organic molecules with tailored properties and functionalities. Its incorporation in the synthesis of target compounds offers chemists a strategic pathway to access diverse chemical space for the discovery and development of new compounds with potential applications in various industries.
FEATURED PRODUCTS