AA33369
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $105.00 | $74.00 | - + | |
5g | 98% | in stock | $297.00 | $208.00 | - + | |
25g | 98% | in stock | $758.00 | $531.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA33369 |
Chemical Name: | Methyl 1-ethyl-1H-benzo[d]imidazole-6-carboxylate |
CAS Number: | 1199773-11-9 |
Molecular Formula: | C11H12N2O2 |
Molecular Weight: | 204.2252 |
MDL Number: | MFCD13195704 |
SMILES: | COC(=O)c1ccc2c(c1)n(CC)cn2 |
Complexity: | 245 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.6 |
Methyl 1-ethyl-1H-benzo[d]imidazole-6-carboxylate is a versatile compound widely utilized in chemical synthesis for its remarkable reactivity and unique structural properties. This compound serves as a valuable building block in the creation of various organic compounds through its ability to undergo diverse chemical reactions.In chemical synthesis, Methyl 1-ethyl-1H-benzo[d]imidazole-6-carboxylate can act as a precursor for the introduction of functional groups or substituents into organic molecules. Its presence in a reaction mixture can facilitate the formation of complex molecular structures by participating in reactions such as esterification, amidation, or substitution.Furthermore, the specific structural features of Methyl 1-ethyl-1H-benzo[d]imidazole-6-carboxylate, including the aromatic benzo[d]imidazole ring and the ethyl and methyl ester groups, impart unique characteristics to the compounds synthesized using it. These properties make it a valuable tool in the development of new pharmaceuticals, agrochemicals, and materials with tailored properties.Overall, Methyl 1-ethyl-1H-benzo[d]imidazole-6-carboxylate plays a crucial role in expanding the synthetic toolbox available to chemists, enabling the efficient and precise construction of diverse organic molecules with a wide range of applications.