AA33510
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $38.00 | $27.00 | - + | |
5mg | 98% | in stock | $84.00 | $59.00 | - + | |
10mg | 98% | in stock | $109.00 | $76.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA33510 |
Chemical Name: | Sulfuretin |
CAS Number: | 120-05-8 |
Molecular Formula: | C15H10O5 |
Molecular Weight: | 270.2369 |
MDL Number: | MFCD00017304 |
SMILES: | Oc1ccc2c(c1)OC(=Cc1ccc(c(c1)O)O)C2=O |
Sulfuretin is a natural compound that has found wide application in chemical synthesis due to its versatile properties. As a polyphenolic flavonoid, Sulfuretin is utilized in the development of various bioactive molecules and pharmaceuticals. Its ability to serve as a precursor for the synthesis of more complex compounds makes it a valuable tool for medicinal chemistry research. In addition, Sulfuretin can also be used as a dye in analytical chemistry and as a probe in fluorescence imaging due to its distinct color and fluorescence properties. Its unique structure and reactivity make Sulfuretin a valuable resource in the field of chemical synthesis.