AA33507
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $12.00 | $8.00 | - + | |
25g | 98% | in stock | $21.00 | $15.00 | - + | |
100g | 98% | in stock | $46.00 | $32.00 | - + | |
500g | 98% | in stock | $189.00 | $133.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA33507 |
Chemical Name: | 1-Benzyloxy-2-methoxy-4-(1-propenyl)benzene |
CAS Number: | 120-11-6 |
Molecular Formula: | C17H18O2 |
Molecular Weight: | 254.3236 |
MDL Number: | MFCD00026985 |
SMILES: | CC=Cc1ccc(c(c1)OC)OCc1ccccc1 |
Complexity: | 268 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 4.1 |
1-(Benzyloxy)-2-methoxy-4-(prop-1-en-1-yl)benzene is a versatile compound commonly utilized in chemical synthesis. Its unique structure and reactivity make it an important building block in organic chemistry.In chemical synthesis, 1-(Benzyloxy)-2-methoxy-4-(prop-1-en-1-yl)benzene can serve as a key intermediate for the preparation of various biologically active compounds and pharmaceuticals. Its ability to undergo different types of reactions, such as substitution, addition, and elimination reactions, allows for the synthesis of complex molecular structures.Furthermore, the presence of both benzyl and propenyl groups in the molecule provides opportunities for further functionalization, enabling the introduction of additional substituents to tailor the compound for specific applications. This compound can also participate in cross-coupling reactions to form carbon-carbon bonds, expanding its synthetic utility.Overall, the versatility and reactivity of 1-(Benzyloxy)-2-methoxy-4-(prop-1-en-1-yl)benzene make it a valuable tool in chemical synthesis, facilitating the creation of diverse and intricate organic molecules for various industrial and research purposes.