AA33495
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $15.00 | $10.00 | - + | |
5g | 98% | in stock | $16.00 | $11.00 | - + | |
25g | 98% | in stock | $28.00 | $19.00 | - + | |
100g | 98% | in stock | $99.00 | $69.00 | - + | |
500g | 98% | in stock | $429.00 | $300.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA33495 |
Chemical Name: | Tropine |
CAS Number: | 120-29-6 |
Molecular Formula: | C8H15NO |
Molecular Weight: | 141.2108 |
MDL Number: | MFCD00005551 |
SMILES: | O[C@@H]1C[C@@H]2CC[C@H](C1)N2C |
Complexity: | 123 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Undefined Atom Stereocenter Count: | 2 |
XLogP3: | 0.8 |
8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-, (3-endo)- is a versatile compound widely utilized in chemical synthesis. This particular molecule serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure and reactivity make it an important intermediate in the synthesis of complex organic molecules with specific biological activities or industrial applications. By incorporating 8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-, (3-endo)- into synthetic pathways, chemists can access diverse chemical functionalities and create novel compounds that have the potential to impact numerous industries positively.