AA33530
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $12.00 | $9.00 | - + | |
5g | 95% | in stock | $23.00 | $17.00 | - + | |
25g | 95% | in stock | $79.00 | $55.00 | - + | |
100g | 98% | in stock | $213.00 | $149.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA33530 |
Chemical Name: | Desoxyanisoin |
CAS Number: | 120-44-5 |
Molecular Formula: | C16H16O3 |
Molecular Weight: | 256.2964 |
MDL Number: | MFCD00008406 |
SMILES: | COc1ccc(cc1)CC(=O)c1ccc(cc1)OC |
Complexity: | 274 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | 3.1 |
Journal of medicinal chemistry 20030410